CAS 389574-19-0 appears in our catalog under these names: Prasugrel Hydrochloride, >95% (HPLC), Prasugrel Hydrochloride, Prasugrel hydrochloride, Prasugrel Hydrochloride/ 99.79% (existing batch purity), Prasugrel hydrochloride, 98.00%. Offered by: TRC, Mikromol, GLPBio, TargetMol, Chemat. Available pack sizes: 10mg, 250mg, 50mg, 100mg, 5mg, 10mM (in 1ml dmso), 25mg, 1g.
[5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] acetate;hydrochloride (CAS 389574-19-0) is a chemical compound with the molecular formula C20H21ClFNO3S and a molecular weight of 409.9 g/mol. IUPAC name: [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] acetate;hydrochloride. InChIKey: JALHGCPDPSNJNY-UHFFFAOYSA-N.
| Molecular formula | C20H21ClFNO3S |
|---|---|
| Molecular weight | 409.9 g/mol |
| IUPAC name | [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] acetate;hydrochloride |
| InChIKey | JALHGCPDPSNJNY-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(S1)CCN(C2)C(C3=CC=CC=C3F)C(=O)C4CC4.Cl |
Computed by PubChem (NCBI)