Prilocaine, 98%
cas: 721-50-6 — see every product listed under this CAS number, including other names
Prilocaine, 98% (CAS 721-50-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 50g, 100g. Offered by: Thermo Scientific (Acros), Chemat, Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 456220010 |
| cas | 721-50-6 |
| size | 1g |
| availability | availability |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 384.86 Pln | |
| Thermo Scientific (Acros) | 5g | 1051.25 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 50g | 371.60 Pln | |
| Chemat | 100g | 650.00 Pln | |
| Chemat | 250g | 1163.60 Pln | |
| Chemat | 500g | 1924.80 Pln | |
| Fluorochem | 1g | 117.68 Pln | |
| Fluorochem | 5g | 180.16 Pln | |
| Fluorochem | 25g | 398.84 Pln | |
| Fluorochem | 100g | 1200.64 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
Prilocaine is an amino acid amide in which N-propyl-DL-alanine and 2-methylaniline have combined to form the amide bond; used as a local anaesthetic. It has a role as an anticonvulsant and a local anaesthetic. It is an amino acid amide and a monocarboxylic acid amide.
Source: ChEBI
| Molecular formula | C13H20N2O |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | N-(2-methylphenyl)-2-(propylamino)propanamide |
| InChIKey | MVFGUOIZUNYYSO-UHFFFAOYSA-N |
| SMILES | CCCNC(C)C(=O)NC1=CC=CC=C1C |
Computed by PubChem (NCBI)