CAS 142773-73-7 appears in our catalog under these names: (2'S,3S)-1-(2-Methylamino-2-phenyl-ethyl)-pyrrolidin-3-ol, 95%, (2'S,3S)-1-(2-Methylamino-2-phenyl-ethyl)-pyrrolidin-3-ol, (S)–1–((S)–2–(Methylamino)–2–phenylethyl)pyrrolidin–3–ol. Offered by: Combi-blocks, TRC, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(3S)-1-[(2S)-2-(methylamino)-2-phenylethyl]pyrrolidin-3-ol (CAS 142773-73-7) is a chemical compound with the molecular formula C13H20N2O and a molecular weight of 220.31 g/mol. IUPAC name: (3S)-1-[(2S)-2-(methylamino)-2-phenylethyl]pyrrolidin-3-ol. InChIKey: HEJUZZDQTLAMIH-QWHCGFSZSA-N.
| Molecular formula | C13H20N2O |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | (3S)-1-[(2S)-2-(methylamino)-2-phenylethyl]pyrrolidin-3-ol |
| InChIKey | HEJUZZDQTLAMIH-QWHCGFSZSA-N |
| SMILES | CN[C@H](CN1CC[C@@H](C1)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)