CAS 281664-76-4 appears in our catalog under these names: Profoxydim Lithium Salt, Profoxydim lithium, Profoxydim lithium 100 µg/mL in Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 1mg, 5mg, 100mg, 1ml, 1x100mg.
Lithium 2-[(E)-N-[2-(4-chlorophenoxy)propoxy]-C-propylcarbonimidoyl]-3-oxo-5-(thian-3-yl)cyclohexen-1-olate (CAS 281664-76-4) is a chemical compound with the molecular formula C24H31ClLiNO4S and a molecular weight of 472.0 g/mol. IUPAC name: lithium 2-[(E)-N-[2-(4-chlorophenoxy)propoxy]-C-propylcarbonimidoyl]-3-oxo-5-(thian-3-yl)cyclohexen-1-olate. InChIKey: LRGTYGSKTGIXOL-HCPJHKKFSA-M.
| Molecular formula | C24H31ClLiNO4S |
|---|---|
| Molecular weight | 472.0 g/mol |
| IUPAC name | lithium 2-[(E)-N-[2-(4-chlorophenoxy)propoxy]-C-propylcarbonimidoyl]-3-oxo-5-(thian-3-yl)cyclohexen-1-olate |
| InChIKey | LRGTYGSKTGIXOL-HCPJHKKFSA-M |
| SMILES | [Li+].CCC/C(=N\OCC(C)OC1=CC=C(C=C1)Cl)/C2=C(CC(CC2=O)C3CCCSC3)[O-] |
Computed by PubChem (NCBI)