Propane-1,2-diyl dioctanoate, 95%
cas: 7384-98-7 — see every product listed under this CAS number, including other names
Propane-1,2-diyl dioctanoate, 95% (CAS 7384-98-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A139702-250mg |
| cas | 7384-98-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 687.44 Pln | |
| Ambeed | 25g | 2545.31 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 242.16 Pln | |
| BLDpharm | 5g | 736.43 Pln | |
| BLDpharm | 25g | 2741.28 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 700.81 Pln | |
| Fluorochem | 25g | 2611.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-octanoyloxypropyl octanoate (CAS 7384-98-7) is a chemical compound with the molecular formula C19H36O4 and a molecular weight of 328.5 g/mol. IUPAC name: 2-octanoyloxypropyl octanoate. InChIKey: OVYMWJFNQQOJBU-UHFFFAOYSA-N.
| Molecular formula | C19H36O4 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | 2-octanoyloxypropyl octanoate |
| InChIKey | OVYMWJFNQQOJBU-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC(C)OC(=O)CCCCCCC |
Computed by PubChem (NCBI)
Synonyms:
Propylene glycol dicaprylate, Propylene glycol dioctanoate, 1,2-Dicaprylin, Octanoic acid, 1-methyl-1,2-ethanediyl ester, Octanoic acid, 1,1'-(1-methyl-1,2-ethanediyl) ester, Propane-1,2-diyl dioctanoate, 2-octanoyloxypropyl octanoate, 1,2-Propanediol dioctanoate, Propylene di(octanoate), 1,2-Propanediyl dioctanoate