Products 7384-98-7
CAS 7384-98-7 appears in our catalog under these names: Propane–1，2–diyl dioctanoate, Propane-1,2-diyl dioctanoate 95%, Propylene glycol dicaprylate, 95%, 95%, Propane-1,2-diyl dioctanoate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
2-octanoyloxypropyl octanoate (CAS 7384-98-7) is a chemical compound with the molecular formula C19H36O4 and a molecular weight of 328.5 g/mol. IUPAC name: 2-octanoyloxypropyl octanoate. InChIKey: OVYMWJFNQQOJBU-UHFFFAOYSA-N.
| Molecular formula | C19H36O4 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | 2-octanoyloxypropyl octanoate |
| InChIKey | OVYMWJFNQQOJBU-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC(C)OC(=O)CCCCCCC |
Computed by PubChem (NCBI)
Synonyms:
Propylene glycol dicaprylate, Propylene glycol dioctanoate, 1,2-Dicaprylin, Octanoic acid, 1-methyl-1,2-ethanediyl ester, Octanoic acid, 1,1'-(1-methyl-1,2-ethanediyl) ester, Propane-1,2-diyl dioctanoate, 2-octanoyloxypropyl octanoate, 1,2-Propanediol dioctanoate, Propylene di(octanoate), 1,2-Propanediyl dioctanoate