cas: 1393330-40-9 — see every product listed under this CAS number, including other names
Propargyl-PEG5-NHS Ester (CAS 1393330-40-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P2283-25MG |
| cas | 1393330-40-9 |
| size | 25mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25mg | 398.63 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 1393330-40-9) is a chemical compound with the molecular formula C18H27NO9 and a molecular weight of 401.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: ACZDUKRWTPZVRP-UHFFFAOYSA-N.
| Molecular formula | C18H27NO9 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | ACZDUKRWTPZVRP-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)