CAS 1393330-40-9 appears in our catalog under these names: Acetylene-peg5-nhs ester, 95%, Propargyl–PEG5–NHS ester, Alkyne-PEG(4)-NHS, Propargyl-PEG5-NHS Ester, Propargyl-PEG5-NHS ester 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, TCI, Ambeed. Available pack sizes: 5g, 100mg, 1g, 25mg, 50mg, 250mg, 50 mg, 1 g.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 1393330-40-9) is a chemical compound with the molecular formula C18H27NO9 and a molecular weight of 401.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: ACZDUKRWTPZVRP-UHFFFAOYSA-N.
| Molecular formula | C18H27NO9 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | ACZDUKRWTPZVRP-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)