CAS 2091-46-5 appears in our catalog under these names: Propargyltriphenylphosphonium bromide/ 97%, Triphenylpropargylphosphonium Bromide, Triphenylpropargylphosphonium Bromide, >98.0%(T), Triphenyl(prop-2-yn-1-yl)phosphonium bromide 95%, Triphenyl(Prop-2-Yn-1-Yl)Phosphonium Bromide, 98%, 98%. Offered by: Chemat, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 10g.
Triphenyl(prop-2-ynyl)phosphanium bromide (CAS 2091-46-5) is a chemical compound with the molecular formula C21H18BrP and a molecular weight of 381.2 g/mol. IUPAC name: triphenyl(prop-2-ynyl)phosphanium bromide. InChIKey: AFZDAWIXETXKRE-UHFFFAOYSA-M.
| Molecular formula | C21H18BrP |
|---|---|
| Molecular weight | 381.2 g/mol |
| IUPAC name | triphenyl(prop-2-ynyl)phosphanium bromide |
| InChIKey | AFZDAWIXETXKRE-UHFFFAOYSA-M |
| SMILES | C#CC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)