CAS 550-83-4 appears in our catalog under these names: Propoxycaine Hydrochloride, >95% (HPLC), Propoxycaine Hydrochloride, Propoxycaine hydrochloride/ 97.25% (existing batch purity), Propoxycaine hydrochloride, Propoxycaine HCl 98%. Offered by: TRC, Mikromol, LoGiCal, TargetMol, GLPBio. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg.
2-(diethylamino)ethyl 4-amino-2-propoxybenzoate;hydrochloride (CAS 550-83-4) is a chemical compound with the molecular formula C16H27ClN2O3 and a molecular weight of 330.8 g/mol. IUPAC name: 2-(diethylamino)ethyl 4-amino-2-propoxybenzoate;hydrochloride. InChIKey: GITPCGSPKUQZTE-UHFFFAOYSA-N.
| Molecular formula | C16H27ClN2O3 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | 2-(diethylamino)ethyl 4-amino-2-propoxybenzoate;hydrochloride |
| InChIKey | GITPCGSPKUQZTE-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=CC(=C1)N)C(=O)OCCN(CC)CC.Cl |
Computed by PubChem (NCBI)