cas: 552-70-5 — see every product listed under this CAS number, including other names
Pseudopelletierine 98% (CAS 552-70-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A655308-250mg |
| cas | 552-70-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 448.25 Pln | |
| Ambeed | 10g | 748.62 Pln | |
| Ambeed | 25g | 1332.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A655308 |
(1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one (CAS 552-70-5) is a chemical compound with the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. IUPAC name: (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one. InChIKey: RHWSKVCZXBAWLZ-OCAPTIKFSA-N.
| Molecular formula | C9H15NO |
|---|---|
| Molecular weight | 153.22 g/mol |
| IUPAC name | (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one |
| InChIKey | RHWSKVCZXBAWLZ-OCAPTIKFSA-N |
| SMILES | CN1[C@@H]2CCC[C@H]1CC(=O)C2 |
Computed by PubChem (NCBI)