CAS 552-70-5 appears in our catalog under these names: Pseudopelletierine, Pseudopelletierine, >98.0%(GC)(T), 9-methyl-9-azabicyclo[3.3.1]nonan-3-one, 98%, 98%, Pseudopelletierine, 99.20%, pseudo-Pelletierine, 98%. Offered by: TRC, TCI, Thermo Scientific (Acros), Chemat, MedChemExpress. Available pack sizes: 10mg, 1g, 5g, 25g, 250mg, 10g, 500 mg, 10mM/1mL.
(1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one (CAS 552-70-5) is a chemical compound with the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. IUPAC name: (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one. InChIKey: RHWSKVCZXBAWLZ-OCAPTIKFSA-N.
| Molecular formula | C9H15NO |
|---|---|
| Molecular weight | 153.22 g/mol |
| IUPAC name | (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one |
| InChIKey | RHWSKVCZXBAWLZ-OCAPTIKFSA-N |
| SMILES | CN1[C@@H]2CCC[C@H]1CC(=O)C2 |
Computed by PubChem (NCBI)