CAS 2013582-27-7 appears in our catalog under these names: Puliginurad/ 99.96% (existing batch purity), Puliginurad, Puliginurad, 99.96%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 25mg, 50mg, 5 mg, 100 mg.
3-[4-(4-cyanophenyl)thieno[2,3-c]pyridin-2-yl]-2,2-dimethylpropanoic acid (CAS 2013582-27-7) is a chemical compound with the molecular formula C19H16N2O2S and a molecular weight of 336.4 g/mol. IUPAC name: 3-[4-(4-cyanophenyl)thieno[2,3-c]pyridin-2-yl]-2,2-dimethylpropanoic acid. InChIKey: QWCZAFGDQBUAFT-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O2S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 3-[4-(4-cyanophenyl)thieno[2,3-c]pyridin-2-yl]-2,2-dimethylpropanoic acid |
| InChIKey | QWCZAFGDQBUAFT-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC2=C(S1)C=NC=C2C3=CC=C(C=C3)C#N)C(=O)O |
Computed by PubChem (NCBI)