cas: 133894-48-1 — see every product listed under this CAS number, including other names
PyCloP 96% (CAS 133894-48-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A222809-5g |
| cas | 133894-48-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 292.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A222809 |
Chloro(tripyrrolidin-1-yl)phosphanium hexafluorophosphate (CAS 133894-48-1) is a chemical compound with the molecular formula C12H24ClF6N3P2 and a molecular weight of 421.73 g/mol. IUPAC name: chloro(tripyrrolidin-1-yl)phosphanium hexafluorophosphate. InChIKey: BSCYRXJVGSZNKX-UHFFFAOYSA-N.
| Molecular formula | C12H24ClF6N3P2 |
|---|---|
| Molecular weight | 421.73 g/mol |
| IUPAC name | chloro(tripyrrolidin-1-yl)phosphanium hexafluorophosphate |
| InChIKey | BSCYRXJVGSZNKX-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)[P+](N2CCCC2)(N3CCCC3)Cl.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)