CAS 133894-48-1 appears in our catalog under these names: Chlorotripyrrolidinophosphonium hexafluorophosphate, 97%, Chlorotripyrrolidinophosphonium Hexafluorophosphate, PyCloP, Chlorotripyrrolidinophosphonium Hexafluorophosphate, >98.0%(HPLC)(T), PyCloP 96%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 500g, 100g, 25g, 10g, 1g, 5g.
Chloro(tripyrrolidin-1-yl)phosphanium hexafluorophosphate (CAS 133894-48-1) is a chemical compound with the molecular formula C12H24ClF6N3P2 and a molecular weight of 421.73 g/mol. IUPAC name: chloro(tripyrrolidin-1-yl)phosphanium hexafluorophosphate. InChIKey: BSCYRXJVGSZNKX-UHFFFAOYSA-N.
| Molecular formula | C12H24ClF6N3P2 |
|---|---|
| Molecular weight | 421.73 g/mol |
| IUPAC name | chloro(tripyrrolidin-1-yl)phosphanium hexafluorophosphate |
| InChIKey | BSCYRXJVGSZNKX-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)[P+](N2CCCC2)(N3CCCC3)Cl.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)