CAS 1160514-60-2 appears in our catalog under these names: Pyr3, >95% (HPLC), Pyr3, Pyr3/ 99.47% (existing batch purity), TRPC3 Channel Inhibitor, Pyr3, TRPC3 Channel Inhibitor, Pyr 1PC X 10MG. Offered by: TRC, GLPBio, TargetMol, Biosynth, Sigma-Aldrich. Available pack sizes: 5mg, 10mg, 50mg, 25mg, 100mg, 200mg, 5 mg, 10 mg.
Ethyl 1-[4-(2,3,3-trichloroprop-2-enoylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate (CAS 1160514-60-2) is a chemical compound with the molecular formula C16H11Cl3F3N3O3 and a molecular weight of 456.6 g/mol. IUPAC name: ethyl 1-[4-(2,3,3-trichloroprop-2-enoylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate. InChIKey: RZHGONNSASQOAY-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl3F3N3O3 |
|---|---|
| Molecular weight | 456.6 g/mol |
| IUPAC name | ethyl 1-[4-(2,3,3-trichloroprop-2-enoylamino)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
| InChIKey | RZHGONNSASQOAY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC=C(C=C2)NC(=O)C(=C(Cl)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)