cas: 928140-28-7 — see every product listed under this CAS number, including other names
Pyridin-3-ylmethanesulfonyl chloride trifluoromethanesulfonate, 95% (CAS 928140-28-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A494924-50mg |
| cas | 928140-28-7 |
| size | 50mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 50mg | 2016.49 Pln | |
| AmBeed | 1g | 11918.20 Pln | |
| AmBeed | 250mg | 3793.72 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Pyridin-3-ylmethanesulfonyl chloride;trifluoromethanesulfonic acid (CAS 928140-28-7) is a chemical compound with the molecular formula C7H7ClF3NO5S2 and a molecular weight of 341.7 g/mol. IUPAC name: pyridin-3-ylmethanesulfonyl chloride;trifluoromethanesulfonic acid. InChIKey: FTWJYPAJVLWLAG-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3NO5S2 |
|---|---|
| Molecular weight | 341.7 g/mol |
| IUPAC name | pyridin-3-ylmethanesulfonyl chloride;trifluoromethanesulfonic acid |
| InChIKey | FTWJYPAJVLWLAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CS(=O)(=O)Cl.C(F)(F)(F)S(=O)(=O)O |
Computed by PubChem (NCBI)