CAS 928140-28-7 appears in our catalog under these names: (3-Pyridylmethyl)sulfonyl chloride triflate, 95%, Pyridin-3-ylmethanesulfonyl chloride trifluoromethanesulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 50mg.
Pyridin-3-ylmethanesulfonyl chloride;trifluoromethanesulfonic acid (CAS 928140-28-7) is a chemical compound with the molecular formula C7H7ClF3NO5S2 and a molecular weight of 341.7 g/mol. IUPAC name: pyridin-3-ylmethanesulfonyl chloride;trifluoromethanesulfonic acid. InChIKey: FTWJYPAJVLWLAG-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3NO5S2 |
|---|---|
| Molecular weight | 341.7 g/mol |
| IUPAC name | pyridin-3-ylmethanesulfonyl chloride;trifluoromethanesulfonic acid |
| InChIKey | FTWJYPAJVLWLAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CS(=O)(=O)Cl.C(F)(F)(F)S(=O)(=O)O |
Computed by PubChem (NCBI)