cas: 20734-22-9 — see every product listed under this CAS number, including other names
Pyridine, 2,5-dibromo-, 1-oxide, 98%, 98% (CAS 20734-22-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113J12-250mg |
| cas | 20734-22-9 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 827.60 Pln | |
| Chemat | 10g | 1283.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,5-dibromo-1-oxidopyridin-1-ium (CAS 20734-22-9) is a chemical compound with the molecular formula C5H3Br2NO and a molecular weight of 252.89 g/mol. IUPAC name: 2,5-dibromo-1-oxidopyridin-1-ium. InChIKey: PULUIMDLAQFXTQ-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2NO |
|---|---|
| Molecular weight | 252.89 g/mol |
| IUPAC name | 2,5-dibromo-1-oxidopyridin-1-ium |
| InChIKey | PULUIMDLAQFXTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=[N+](C=C1Br)[O-])Br |
Computed by PubChem (NCBI)