Products 20734-22-9
CAS 20734-22-9 appears in our catalog under these names: 2,5-Dibromopyridine 1-oxide, 96%, 2,5-Dibromopyridine 1-oxide, 98%, 2，5–Dibromopyridine 1–oxide, 2,5-Dibromopyridine 1-oxide 98%, Pyridine, 2,5-dibromo-, 1-oxide, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 250mg.
2,5-dibromo-1-oxidopyridin-1-ium (CAS 20734-22-9) is a chemical compound with the molecular formula C5H3Br2NO and a molecular weight of 252.89 g/mol. IUPAC name: 2,5-dibromo-1-oxidopyridin-1-ium. InChIKey: PULUIMDLAQFXTQ-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2NO |
|---|---|
| Molecular weight | 252.89 g/mol |
| IUPAC name | 2,5-dibromo-1-oxidopyridin-1-ium |
| InChIKey | PULUIMDLAQFXTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=[N+](C=C1Br)[O-])Br |
Computed by PubChem (NCBI)