cas: 128249-70-7 — see every product listed under this CAS number, including other names
Pyridine, 2,6-bis[(4R)-4,5-dihydro-4-phenyl-2-oxazolyl]-, 98% 99%ee, 98% 99%ee (CAS 128249-70-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 10g, 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111XWO-500mg |
| cas | 128249-70-7 |
| size | 500mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 98.00 Pln | |
| Chemat | 10g | 515.60 Pln | |
| Chemat | 100g | 2853.20 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 25g | 933.20 Pln |
| purity | 98% 99%ee |
|---|---|
| delivery time | 3 weeks |
(4R)-4-phenyl-2-[6-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole (CAS 128249-70-7) is a chemical compound with the molecular formula C23H19N3O2 and a molecular weight of 369.4 g/mol. IUPAC name: (4R)-4-phenyl-2-[6-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole. InChIKey: HLHBIMJNCKZZQO-SFTDATJTSA-N.
| Molecular formula | C23H19N3O2 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (4R)-4-phenyl-2-[6-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
| InChIKey | HLHBIMJNCKZZQO-SFTDATJTSA-N |
| SMILES | C1[C@H](N=C(O1)C2=NC(=CC=C2)C3=N[C@@H](CO3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)