Pyrrolidine, 3-(phenylmethoxy)-, hydrochloride (1:1), (3S)-, 95%+, 95%+
cas: 931409-74-4 — see every product listed under this CAS number, including other names
Pyrrolidine, 3-(phenylmethoxy)-, hydrochloride (1:1), (3S)-, 95%+, 95%+ (CAS 931409-74-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GSM5-100mg |
| cas | 931409-74-4 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 2128.40 Pln |
properties
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
(3S)-3-phenylmethoxypyrrolidine;hydrochloride (CAS 931409-74-4) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (3S)-3-phenylmethoxypyrrolidine;hydrochloride. InChIKey: HIPRPABXTKKPPY-MERQFXBCSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (3S)-3-phenylmethoxypyrrolidine;hydrochloride |
| InChIKey | HIPRPABXTKKPPY-MERQFXBCSA-N |
| SMILES | C1CNC[C@H]1OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3S)-3-(Benzyloxy)pyrrolidine--hydrogen chloride (1/1), (s)-3-benzyloxy-pyrrolidine hydrochloride, (s)-3-(benzyloxy)pyrrolidine hydrochloride, (S)-3-Benzyloxypyrrolidine hydrochloride, (3S)-3-phenylmethoxypyrrolidine;hydrochloride, (S)-3-(Benzyloxy)pyrrolidine HCl, (3S)-3-benzyloxypyrrolidine;hydrochloride, (3s)-3-(benzyloxy)pyrrolidine hydrochloride, (s)-3-(benzyloxy)pyrrolidinehydrochloride