cas: 1196155-05-1 — see every product listed under this CAS number, including other names
Pyrrolo(3,4-c)pyrazole-5(1H)-carboxylic acid, 3-amino-4,6-dihydro-6-methyl-, 1,1-dimethylethyl ester, 98% (CAS 1196155-05-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1153198-5g |
| cas | 1196155-05-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 20569.99 Pln | |
| AmBeed | 1g | 6052.69 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 3-amino-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1196155-05-1) is a chemical compound with the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. IUPAC name: tert-butyl 3-amino-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: BXCWXKSMKKEXCN-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O2 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | tert-butyl 3-amino-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | BXCWXKSMKKEXCN-UHFFFAOYSA-N |
| SMILES | CC1C2=C(CN1C(=O)OC(C)(C)C)C(=NN2)N |
Computed by PubChem (NCBI)