Products 1240800-82-1
CAS 1240800-82-1 is the registry number for N2,N2,2-Trimethyl-N1-(5-nitropyridin-2-yl)propane-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-N,2-N,2-trimethyl-1-N-(5-nitro-2-pyridinyl)propane-1,2-diamine (CAS 1240800-82-1) is a chemical compound with the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. IUPAC name: 2-N,2-N,2-trimethyl-1-N-(5-nitro-2-pyridinyl)propane-1,2-diamine. InChIKey: GKKMWVQGMRRSOC-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O2 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | 2-N,2-N,2-trimethyl-1-N-(5-nitro-2-pyridinyl)propane-1,2-diamine |
| InChIKey | GKKMWVQGMRRSOC-UHFFFAOYSA-N |
| SMILES | CC(C)(CNC1=NC=C(C=C1)[N+](=O)[O-])N(C)C |
Computed by PubChem (NCBI)