cas: 1196155-05-1 — see every product listed under this CAS number, including other names
Pyrrolo[3,4-c]pyrazole-5(1H)-carboxylic acid, 3-amino-4,6-dihydro-6-methyl-, 1,1-dimethylethyl ester, 96%, 96% (CAS 1196155-05-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DY9C-100mg |
| cas | 1196155-05-1 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 914.00 Pln | |
| Chemat | 250mg | 1557.20 Pln | |
| Chemat | 1g | 3050.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-amino-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1196155-05-1) is a chemical compound with the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. IUPAC name: tert-butyl 3-amino-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: BXCWXKSMKKEXCN-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O2 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | tert-butyl 3-amino-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | BXCWXKSMKKEXCN-UHFFFAOYSA-N |
| SMILES | CC1C2=C(CN1C(=O)OC(C)(C)C)C(=NN2)N |
Computed by PubChem (NCBI)