CAS 1237744-13-6 appears in our catalog under these names: QNZ46/ 99.64% (existing batch purity), QNZ 46, QNZ 46, QNZ46, QNZ46, 99.46%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
4-[6-methoxy-2-[(E)-2-(3-nitrophenyl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid (CAS 1237744-13-6) is a chemical compound with the molecular formula C24H17N3O6 and a molecular weight of 443.4 g/mol. IUPAC name: 4-[6-methoxy-2-[(E)-2-(3-nitrophenyl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid. InChIKey: GNLVJIICVWDSNI-LFYBBSHMSA-N.
| Molecular formula | C24H17N3O6 |
|---|---|
| Molecular weight | 443.4 g/mol |
| IUPAC name | 4-[6-methoxy-2-[(E)-2-(3-nitrophenyl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid |
| InChIKey | GNLVJIICVWDSNI-LFYBBSHMSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(N(C2=O)C3=CC=C(C=C3)C(=O)O)/C=C/C4=CC(=CC=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)