R,S-Fmoc-3-amino-2-(3,4-dimethoxy-benzyl)-propionic acid 97%
cas: 1076197-02-8 — see every product listed under this CAS number, including other names
R,S-Fmoc-3-amino-2-(3,4-dimethoxy-benzyl)-propionic acid 97% (CAS 1076197-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A909085-100mg |
| cas | 1076197-02-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 748.62 Pln | |
| Ambeed | 250mg | 893.25 Pln | |
| Ambeed | 1g | 2567.56 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A909085 |
2-[(3,4-dimethoxyphenyl)methyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1076197-02-8) is a chemical compound with the molecular formula C27H27NO6 and a molecular weight of 461.5 g/mol. IUPAC name: 2-[(3,4-dimethoxyphenyl)methyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ZGOFWUMBCCURJY-UHFFFAOYSA-N.
| Molecular formula | C27H27NO6 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | 2-[(3,4-dimethoxyphenyl)methyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ZGOFWUMBCCURJY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC(CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O)OC |
Computed by PubChem (NCBI)