CAS 1425938-66-4 appears in our catalog under these names: Fmoc-(dmb)ala-oh, 95%, Fmoc–(Dmb)Ala–OH, Fmoc-L-DmbAla-OH, Fmoc-(Dmb)Ala-OH 95%, L-Alanine, N-[(2,4-dimethoxyphenyl)methyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 100 mg, 1 g, 5 g.
(2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (CAS 1425938-66-4) is a chemical compound with the molecular formula C27H27NO6 and a molecular weight of 461.5 g/mol. IUPAC name: (2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid. InChIKey: BTEPUGBDZZZLCU-KRWDZBQOSA-N.
| Molecular formula | C27H27NO6 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | (2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| InChIKey | BTEPUGBDZZZLCU-KRWDZBQOSA-N |
| SMILES | C[C@@H](C(=O)O)N(CC1=C(C=C(C=C1)OC)OC)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)