CAS 303997-35-5 appears in our catalog under these names: R–7050, R-7050/ 99.14% (existing batch purity), TNF-± Antagonist III, R-7050, R-7050 99%, TNF-╬▒ Antagonist III, R-7050 1PC X 10MG. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg.
8-chloro-4-phenylsulfanyl-1-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxaline (CAS 303997-35-5) is a chemical compound with the molecular formula C16H8ClF3N4S and a molecular weight of 380.8 g/mol. IUPAC name: 8-chloro-4-phenylsulfanyl-1-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxaline. InChIKey: SUUMKHOVGVYGOP-UHFFFAOYSA-N.
| Molecular formula | C16H8ClF3N4S |
|---|---|
| Molecular weight | 380.8 g/mol |
| IUPAC name | 8-chloro-4-phenylsulfanyl-1-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxaline |
| InChIKey | SUUMKHOVGVYGOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=NC3=C(C=C(C=C3)Cl)N4C2=NN=C4C(F)(F)F |
Computed by PubChem (NCBI)