cas: 114681-65-1 — see every product listed under this CAS number, including other names
RGD peptide (GRGDNP) 99% (CAS 114681-65-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A364041-1mg |
| cas | 114681-65-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 181.25 Pln | |
| Ambeed | 5mg | 348.12 Pln | |
| Ambeed | 10mg | 537.25 Pln | |
| Ambeed | 25mg | 998.94 Pln | |
| Ambeed | 50mg | 1638.62 Pln | |
| Ambeed | 100mg | 2728.88 Pln | |
| Ambeed | 250mg | 5393.31 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A364041 |
(2S)-1-[(2S)-4-amino-2-[[(2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid (CAS 114681-65-1) is a chemical compound with the molecular formula C23H38N10O10 and a molecular weight of 614.6 g/mol. IUPAC name: (2S)-1-[(2S)-4-amino-2-[[(2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid. InChIKey: CWAHAVYVGPRZJU-XUXIUFHCSA-N.
| Molecular formula | C23H38N10O10 |
|---|---|
| Molecular weight | 614.6 g/mol |
| IUPAC name | (2S)-1-[(2S)-4-amino-2-[[(2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | CWAHAVYVGPRZJU-XUXIUFHCSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)[C@H](CC(=O)N)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CN)C(=O)O |
Computed by PubChem (NCBI)