CAS 302901-13-9 appears in our catalog under these names: RH01687/ 98.16% (existing batch purity), RH01687, RH01687, ≥98%, ≥98%, RH01687, 99.85%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
3-(4-chloro-2-nitro-5-pyrrol-1-ylphenyl)sulfanyl-1H-1,2,4-triazol-5-amine (CAS 302901-13-9) is a chemical compound with the molecular formula C12H9ClN6O2S and a molecular weight of 336.76 g/mol. IUPAC name: 3-(4-chloro-2-nitro-5-pyrrol-1-ylphenyl)sulfanyl-1H-1,2,4-triazol-5-amine. InChIKey: BOVTVNWNYFQVMI-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN6O2S |
|---|---|
| Molecular weight | 336.76 g/mol |
| IUPAC name | 3-(4-chloro-2-nitro-5-pyrrol-1-ylphenyl)sulfanyl-1H-1,2,4-triazol-5-amine |
| InChIKey | BOVTVNWNYFQVMI-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC(=C(C=C2Cl)[N+](=O)[O-])SC3=NNC(=N3)N |
Computed by PubChem (NCBI)