CAS 1417162-36-7 appears in our catalog under these names: RI-2/ 98.85% (existing batch purity), RI–2, RI-2 98+%, RI-2, RI-2, 99.90%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
1-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione (CAS 1417162-36-7) is a chemical compound with the molecular formula C21H18Cl2N2O4 and a molecular weight of 433.3 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione. InChIKey: JMPJNNOSVCHYOU-UHFFFAOYSA-N.
| Molecular formula | C21H18Cl2N2O4 |
|---|---|
| Molecular weight | 433.3 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione |
| InChIKey | JMPJNNOSVCHYOU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)N(C2=O)C3=CC(=C(C=C3)Cl)Cl)N4CCOCC4 |
Computed by PubChem (NCBI)