CAS 2300982-44-7 appears in our catalog under these names: RIPK1-IN-7, RIPK1-IN-7 98+%, RIPK1-IN-7, 98.56%, RIPK1-IN-7, 98+%, 98+%, RIPK1-IN-7/ 98.02% (existing batch purity). Offered by: Biosynth, Ambeed, MedChemExpress, Chemat, TargetMol. Available pack sizes: 10mg, 25mg, 50mg, 1mg, 5mg, 100mg, 25 mg, 5 mg.
1-[5-(4-amino-7-ethylpyrrolo[2,3-d]pyrimidin-5-yl)-2,3-dihydroindol-1-yl]-2-[3-(trifluoromethoxy)phenyl]ethanone (CAS 2300982-44-7) is a chemical compound with the molecular formula C25H22F3N5O2 and a molecular weight of 481.5 g/mol. IUPAC name: 1-[5-(4-amino-7-ethylpyrrolo[2,3-d]pyrimidin-5-yl)-2,3-dihydroindol-1-yl]-2-[3-(trifluoromethoxy)phenyl]ethanone. InChIKey: APPXQUDJLJXULP-UHFFFAOYSA-N.
| Molecular formula | C25H22F3N5O2 |
|---|---|
| Molecular weight | 481.5 g/mol |
| IUPAC name | 1-[5-(4-amino-7-ethylpyrrolo[2,3-d]pyrimidin-5-yl)-2,3-dihydroindol-1-yl]-2-[3-(trifluoromethoxy)phenyl]ethanone |
| InChIKey | APPXQUDJLJXULP-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C2=C(N=CN=C21)N)C3=CC4=C(C=C3)N(CC4)C(=O)CC5=CC(=CC=C5)OC(F)(F)F |
Computed by PubChem (NCBI)