CAS 2885227-09-6 appears in our catalog under these names: RIPK2-IN-5/ 98.85% (existing batch purity), RIPK2–IN–5, RIPK2-IN-5, RIPK2-IN-5, 99.73%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 2mg, 10 mg.
N-(6-pyridin-4-ylquinolin-4-yl)-1,3-benzothiazol-5-amine (CAS 2885227-09-6) is a chemical compound with the molecular formula C21H14N4S and a molecular weight of 354.4 g/mol. IUPAC name: N-(6-pyridin-4-ylquinolin-4-yl)-1,3-benzothiazol-5-amine. InChIKey: DDRVRFLMLJHXSY-UHFFFAOYSA-N.
| Molecular formula | C21H14N4S |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | N-(6-pyridin-4-ylquinolin-4-yl)-1,3-benzothiazol-5-amine |
| InChIKey | DDRVRFLMLJHXSY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C=C1C3=CC=NC=C3)NC4=CC5=C(C=C4)SC=N5 |
Computed by PubChem (NCBI)