cas: 1342278-01-6 — see every product listed under this CAS number, including other names
RKI-1447 99% (CAS 1342278-01-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A317869-1mg |
| cas | 1342278-01-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 281.38 Pln | |
| Ambeed | 5mg | 320.31 Pln | |
| Ambeed | 10mg | 492.75 Pln | |
| Ambeed | 50mg | 1104.63 Pln | |
| Ambeed | 100mg | 1321.56 Pln | |
| Ambeed | 250mg | 2322.81 Pln | |
| Ambeed | 1g | 5677.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A317869 |
1-[(3-hydroxyphenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea (CAS 1342278-01-6) is a chemical compound with the molecular formula C16H14N4O2S and a molecular weight of 326.4 g/mol. IUPAC name: 1-[(3-hydroxyphenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea. InChIKey: GDVRVPIXWXOKQO-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O2S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1-[(3-hydroxyphenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea |
| InChIKey | GDVRVPIXWXOKQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)CNC(=O)NC2=NC(=CS2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)