CAS 1342278-01-6 appears in our catalog under these names: 1-[(3-Hydroxyphenyl)methyl]-3-[4-(pyridin-4-yl)-1,3-thiazol-2-yl]urea, 95%, RKI-1447, >95% (HPLC), RKI-1447/ 99.56% (existing batch purity), RKI–1447, RKI-1447. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 500mg, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 200mg.
1-[(3-hydroxyphenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea (CAS 1342278-01-6) is a chemical compound with the molecular formula C16H14N4O2S and a molecular weight of 326.4 g/mol. IUPAC name: 1-[(3-hydroxyphenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea. InChIKey: GDVRVPIXWXOKQO-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O2S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1-[(3-hydroxyphenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea |
| InChIKey | GDVRVPIXWXOKQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)CNC(=O)NC2=NC(=CS2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)