CAS 946387-07-1 appears in our catalog under these names: 2,4-Dichloro-N-(1-methylethyl)-N-[2-[(1-methylethyl)amino]ethyl]benzenesulfonamide, 98%, 98%, RN 1734, RN-1734/ 98%, RN 1734, ((2,4-dichlorophenyl)sulfonyl)(isopropyl)(2-((isopropyl)amino)ethyl)amine. Offered by: Chemat, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 200mg.
2,4-dichloro-N-propan-2-yl-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide (CAS 946387-07-1) is a chemical compound with the molecular formula C14H22Cl2N2O2S and a molecular weight of 353.3 g/mol. IUPAC name: 2,4-dichloro-N-propan-2-yl-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide. InChIKey: IHYZMEAZAIFMTN-UHFFFAOYSA-N.
| Molecular formula | C14H22Cl2N2O2S |
|---|---|
| Molecular weight | 353.3 g/mol |
| IUPAC name | 2,4-dichloro-N-propan-2-yl-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide |
| InChIKey | IHYZMEAZAIFMTN-UHFFFAOYSA-N |
| SMILES | CC(C)NCCN(C(C)C)S(=O)(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)