CAS 431980-38-0 appears in our catalog under these names: RN-18/ 98.39% (existing batch purity), RN–18, RN-18, RN-18, ≥98%, ≥98%, RN-18, 98.75%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg, 10mM/1mL.
N-(2-methoxyphenyl)-2-(4-nitrophenyl)sulfanylbenzamide (CAS 431980-38-0) is a chemical compound with the molecular formula C20H16N2O4S and a molecular weight of 380.4 g/mol. IUPAC name: N-(2-methoxyphenyl)-2-(4-nitrophenyl)sulfanylbenzamide. InChIKey: JKNUDHUHXMELIJ-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4S |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | N-(2-methoxyphenyl)-2-(4-nitrophenyl)sulfanylbenzamide |
| InChIKey | JKNUDHUHXMELIJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NC(=O)C2=CC=CC=C2SC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)