CAS 1803003-68-0 appears in our catalog under these names: RN-9893, 98%, RN9893/ 99.89% (existing batch purity), RN–9893, RN 9893 hydrochloride, RN-9893 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
2-nitro-N-[4-(4-propan-2-ylpiperazin-1-yl)sulfonylphenyl]-4-(trifluoromethyl)benzamide (CAS 1803003-68-0) is a chemical compound with the molecular formula C21H23F3N4O5S and a molecular weight of 500.5 g/mol. IUPAC name: 2-nitro-N-[4-(4-propan-2-ylpiperazin-1-yl)sulfonylphenyl]-4-(trifluoromethyl)benzamide. InChIKey: KORKKQLDGMHNKO-UHFFFAOYSA-N.
| Molecular formula | C21H23F3N4O5S |
|---|---|
| Molecular weight | 500.5 g/mol |
| IUPAC name | 2-nitro-N-[4-(4-propan-2-ylpiperazin-1-yl)sulfonylphenyl]-4-(trifluoromethyl)benzamide |
| InChIKey | KORKKQLDGMHNKO-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=C(C=C(C=C3)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)