CAS 691868-88-9 appears in our catalog under these names: RO8191/ 98.85% (existing batch purity), RO8191, RO8191 90%, RO8191, 90%, 90%, RO8191, 99.0%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
2-[2,4-bis(trifluoromethyl)imidazo[1,2-a][1,8]naphthyridin-8-yl]-1,3,4-oxadiazole (CAS 691868-88-9) is a chemical compound with the molecular formula C14H5F6N5O and a molecular weight of 373.21 g/mol. IUPAC name: 2-[2,4-bis(trifluoromethyl)imidazo[1,2-a][1,8]naphthyridin-8-yl]-1,3,4-oxadiazole. InChIKey: GRHYZVJEXKTJOS-UHFFFAOYSA-N.
| Molecular formula | C14H5F6N5O |
|---|---|
| Molecular weight | 373.21 g/mol |
| IUPAC name | 2-[2,4-bis(trifluoromethyl)imidazo[1,2-a][1,8]naphthyridin-8-yl]-1,3,4-oxadiazole |
| InChIKey | GRHYZVJEXKTJOS-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C3=C1C(=CC(=N3)C(F)(F)F)C(F)(F)F)C4=NN=CO4 |
Computed by PubChem (NCBI)