CAS 135239-65-5 appears in our catalog under these names: RP–64477, RP-64477/ 99.16% (existing batch purity), RP-64477, RP-64477, 99.62%, N-Butyl-3-(4-(decyloxy)benzamido)-4-(methylthio)benzamide, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
N-butyl-3-[(4-decoxybenzoyl)amino]-4-methylsulfanylbenzamide (CAS 135239-65-5) is a chemical compound with the molecular formula C29H42N2O3S and a molecular weight of 498.7 g/mol. IUPAC name: N-butyl-3-[(4-decoxybenzoyl)amino]-4-methylsulfanylbenzamide. InChIKey: OZMWNRSILHTVFV-UHFFFAOYSA-N.
| Molecular formula | C29H42N2O3S |
|---|---|
| Molecular weight | 498.7 g/mol |
| IUPAC name | N-butyl-3-[(4-decoxybenzoyl)amino]-4-methylsulfanylbenzamide |
| InChIKey | OZMWNRSILHTVFV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC1=CC=C(C=C1)C(=O)NC2=C(C=CC(=C2)C(=O)NCCCC)SC |
Computed by PubChem (NCBI)