CAS 312756-74-4 appears in our catalog under these names: 3-(N-Benzylsulfamoyl)-4-bromo-N-(4-bromophenyl)benzamide, ≥98%(HPLC), RS-1/ 99.72% (existing batch purity), RS–1, RS-1, >98.0%(HPLC)(qNMR), RS-1, 98%, 98%. Offered by: Fluorochem, TargetMol, GLPBio, TCI, Chemat. Available pack sizes: 5mg, 100mg, 250mg, 10mg, 25mg, 50mg, 200mg, 500mg.
3-(benzylsulfamoyl)-4-bromo-N-(4-bromophenyl)benzamide (CAS 312756-74-4) is a chemical compound with the molecular formula C20H16Br2N2O3S and a molecular weight of 524.2 g/mol. IUPAC name: 3-(benzylsulfamoyl)-4-bromo-N-(4-bromophenyl)benzamide. InChIKey: SWKAVEUTKGKHSR-UHFFFAOYSA-N.
| Molecular formula | C20H16Br2N2O3S |
|---|---|
| Molecular weight | 524.2 g/mol |
| IUPAC name | 3-(benzylsulfamoyl)-4-bromo-N-(4-bromophenyl)benzamide |
| InChIKey | SWKAVEUTKGKHSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNS(=O)(=O)C2=C(C=CC(=C2)C(=O)NC3=CC=C(C=C3)Br)Br |
Computed by PubChem (NCBI)