CAS 152814-89-6 appears in our catalog under these names: RS-25344/ 99.02% (existing batch purity), RS-25344, 1-(3-Nitrophenyl)-3-(pyridin-4-ylmethyl)pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
1-(3-nitrophenyl)-3-(pyridin-4-ylmethyl)pyrido[2,3-d]pyrimidine-2,4-dione (CAS 152814-89-6) is a chemical compound with the molecular formula C19H13N5O4 and a molecular weight of 375.3 g/mol. IUPAC name: 1-(3-nitrophenyl)-3-(pyridin-4-ylmethyl)pyrido[2,3-d]pyrimidine-2,4-dione. InChIKey: YLHRMVRLIOIWTO-UHFFFAOYSA-N.
| Molecular formula | C19H13N5O4 |
|---|---|
| Molecular weight | 375.3 g/mol |
| IUPAC name | 1-(3-nitrophenyl)-3-(pyridin-4-ylmethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| InChIKey | YLHRMVRLIOIWTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])N2C3=C(C=CC=N3)C(=O)N(C2=O)CC4=CC=NC=C4 |
Computed by PubChem (NCBI)