CAS 154992-24-2 appears in our catalog under these names: RU 58841/ 99.77% (existing batch purity), RU 58841, RU 58841, RU 58841 99%, 4-[3-(4-Hydroxybutyl)-4,4-dimethyl-2,5-dioxo-1-imidazolidinyl]-2-(trifluoromethyl)benzonitrile, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso), 0,1g.
4-[3-(4-hydroxybutyl)-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (CAS 154992-24-2) is a chemical compound with the molecular formula C17H18F3N3O3 and a molecular weight of 369.34 g/mol. IUPAC name: 4-[3-(4-hydroxybutyl)-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile. InChIKey: ARBYGDBJECGMGA-UHFFFAOYSA-N.
| Molecular formula | C17H18F3N3O3 |
|---|---|
| Molecular weight | 369.34 g/mol |
| IUPAC name | 4-[3-(4-hydroxybutyl)-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| InChIKey | ARBYGDBJECGMGA-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1CCCCO)C2=CC(=C(C=C2)C#N)C(F)(F)F)C |
Computed by PubChem (NCBI)