CAS 2351104-40-8 appears in our catalog under these names: RXFP3/4 agonist 1, RXFP3/4 agonist 1. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
2-[2-(4-chlorophenyl)ethyl]-1-[(E)-(7-ethyl-5-hydroxy-1H-indol-3-yl)methylideneamino]guanidine (CAS 2351104-40-8) is a chemical compound with the molecular formula C20H22ClN5O and a molecular weight of 383.9 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)ethyl]-1-[(E)-(7-ethyl-5-hydroxy-1H-indol-3-yl)methylideneamino]guanidine. InChIKey: NQWXHRRWWPCDAJ-BRJLIKDPSA-N.
| Molecular formula | C20H22ClN5O |
|---|---|
| Molecular weight | 383.9 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)ethyl]-1-[(E)-(7-ethyl-5-hydroxy-1H-indol-3-yl)methylideneamino]guanidine |
| InChIKey | NQWXHRRWWPCDAJ-BRJLIKDPSA-N |
| SMILES | CCC1=C2C(=CC(=C1)O)C(=CN2)/C=N/NC(=NCCC3=CC=C(C=C3)Cl)N |
Computed by PubChem (NCBI)