CAS 220904-99-4 appears in our catalog under these names: Raf inhibitor 2, Raf inhibitor 2/ 100%, CID-25014542, Raf inhibitor 2, 98.48%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 2mg, 100mg, 200mg, 1mg.
(3Z)-5-chloro-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one (CAS 220904-99-4) is a chemical compound with the molecular formula C15H8Br2ClNO2 and a molecular weight of 429.49 g/mol. IUPAC name: (3Z)-5-chloro-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one. InChIKey: MPIHOJMBMIMKAJ-KMKOMSMNSA-N.
| Molecular formula | C15H8Br2ClNO2 |
|---|---|
| Molecular weight | 429.49 g/mol |
| IUPAC name | (3Z)-5-chloro-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
| InChIKey | MPIHOJMBMIMKAJ-KMKOMSMNSA-N |
| SMILES | C1=CC2=C(C=C1Cl)/C(=C/C3=CC(=C(C(=C3)Br)O)Br)/C(=O)N2 |
Computed by PubChem (NCBI)