CAS 2133417-13-5 appears in our catalog under these names: Ralmitaront, Ralmitaront/ 99.7% (existing batch purity), (S)-5-Ethyl-4-methyl-N-(4-(morpholin-2-yl)phenyl)-1H-pyrazole-3-carboxamide, 98%, 98%, Ralmitaront, 99.92%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
5-ethyl-4-methyl-N-[4-[(2S)-morpholin-2-yl]phenyl]-1H-pyrazole-3-carboxamide (CAS 2133417-13-5) is a chemical compound with the molecular formula C17H22N4O2 and a molecular weight of 314.4 g/mol. IUPAC name: 5-ethyl-4-methyl-N-[4-[(2S)-morpholin-2-yl]phenyl]-1H-pyrazole-3-carboxamide. InChIKey: XHHXGKRFUPEPFM-OAHLLOKOSA-N.
| Molecular formula | C17H22N4O2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 5-ethyl-4-methyl-N-[4-[(2S)-morpholin-2-yl]phenyl]-1H-pyrazole-3-carboxamide |
| InChIKey | XHHXGKRFUPEPFM-OAHLLOKOSA-N |
| SMILES | CCC1=C(C(=NN1)C(=O)NC2=CC=C(C=C2)[C@H]3CNCCO3)C |
Computed by PubChem (NCBI)