CAS 2242616-04-0 appears in our catalog under these names: Raphin1 (acetate), 95%, Raphin1 acetate/ 99.88% (existing batch purity), Raphin1 acetate, Raphin1 acetate, 99%, 99%, Raphin1 (acetate), 99.93%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 1g, 5mg, 10mg, 25mg, 50mg, 200mg.
Acetic acid;2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine (CAS 2242616-04-0) is a chemical compound with the molecular formula C10H12Cl2N4O2 and a molecular weight of 291.13 g/mol. IUPAC name: acetic acid;2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine. InChIKey: WSDLUFBVKWLRSN-GAYQJXMFSA-N.
| Molecular formula | C10H12Cl2N4O2 |
|---|---|
| Molecular weight | 291.13 g/mol |
| IUPAC name | acetic acid;2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine |
| InChIKey | WSDLUFBVKWLRSN-GAYQJXMFSA-N |
| SMILES | CC(=O)O.C1=CC(=C(C(=C1)Cl)Cl)/C=N/N=C(N)N |
Computed by PubChem (NCBI)