CAS 674359-73-0 appears in our catalog under these names: Rasarfin/ 98.58% (existing batch purity), Rasarfin, N-[3-Chloro-4-[4-(2-methyl-1-oxopropyl)-1-piperazinyl]phenyl]-2-benzofurancarboxamide, 98.58% ,, 98.58% ,, Rasarfin, 99.57%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM/1mL.
N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-1-benzofuran-2-carboxamide (CAS 674359-73-0) is a chemical compound with the molecular formula C23H24ClN3O3 and a molecular weight of 425.9 g/mol. IUPAC name: N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-1-benzofuran-2-carboxamide. InChIKey: SRZCCUYFJZQLGE-UHFFFAOYSA-N.
| Molecular formula | C23H24ClN3O3 |
|---|---|
| Molecular weight | 425.9 g/mol |
| IUPAC name | N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]-1-benzofuran-2-carboxamide |
| InChIKey | SRZCCUYFJZQLGE-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)N1CCN(CC1)C2=C(C=C(C=C2)NC(=O)C3=CC4=CC=CC=C4O3)Cl |
Computed by PubChem (NCBI)