CAS 334969-03-8 appears in our catalog under these names: Recilisib/ 99.84% (existing batch purity), Recilisib (Ex–RAD), Recilisib 98%, (E)-4-(2-((4-Chlorobenzyl)sulfonyl)vinyl)benzoic acid, 98%, 98%, Recilisib, 99.94%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
4-[(E)-2-[(4-chlorophenyl)methylsulfonyl]ethenyl]benzoic acid (CAS 334969-03-8) is a chemical compound with the molecular formula C16H13ClO4S and a molecular weight of 336.8 g/mol. IUPAC name: 4-[(E)-2-[(4-chlorophenyl)methylsulfonyl]ethenyl]benzoic acid. InChIKey: KBEKQQJUNVQLDZ-MDZDMXLPSA-N.
| Molecular formula | C16H13ClO4S |
|---|---|
| Molecular weight | 336.8 g/mol |
| IUPAC name | 4-[(E)-2-[(4-chlorophenyl)methylsulfonyl]ethenyl]benzoic acid |
| InChIKey | KBEKQQJUNVQLDZ-MDZDMXLPSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)/C=C/C2=CC=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)